Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 36

1.
an image of a chemical structure CID 445694

H-Phe-NH2; 5241-58-7; Phenylalanine amide ...

MW:
164.200
g/mol
MF:
C9H12N2O
IUPAC name:
(2S)-2-amino-3-phenylpropanamide
Create Date:
2005-06-24
2.
an image of a chemical structure CID 155640845

MW:
165.210
g/mol
MF:
C9H12N2O
IUPAC name:
(2S)-2-amino-2-deuterio-3-phenylpropanamide
Create Date:
2021-02-21
3.
an image of a chemical structure CID 155640839

MW:
172.250
g/mol
MF:
C9H12N2O
IUPAC name:
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophe...
Create Date:
2021-02-21
4.
an image of a chemical structure CID 155640837

MW:
169.230
g/mol
MF:
C9H12N2O
IUPAC name:
(2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanamide
Create Date:
2021-02-21
5.
an image of a chemical structure CID 90381448

SCHEMBL16001480

MW:
165.210
g/mol
MF:
C9H12N2O
IUPAC name:
(2S)-2-(deuterioamino)-3-phenylpropanamide
Create Date:
2015-02-13
6.
an image of a chemical structure CID 90381447

SCHEMBL16001479

MW:
165.210
g/mol
MF:
C9H12N2O
IUPAC name:
2-(deuterioamino)-3-phenylpropanamide
Create Date:
2015-02-13
7.
an image of a chemical structure CID 7000171

D-Phenylalaninamide; 5241-59-8; H-D-PHE-NH2 ...

MW:
164.200
g/mol
MF:
C9H12N2O
IUPAC name:
(2R)-2-amino-3-phenylpropanamide
Create Date:
2006-07-29
8.
an image of a chemical structure CID 194097

2-Amino-3-phenylpropanamide; 17193-31-6; H-D-Phe-NH ...

MW:
164.200
g/mol
MF:
C9H12N2O
IUPAC name:
2-amino-3-phenylpropanamide
Create Date:
2005-03-27
9.
an image of a chemical structure CID 156086358

SCHEMBL23002157

MW:
364.900
g/mol
MF:
C18H25ClN4O2
IUPAC name:
(2R)-2-amino-3-phenylpropanamide;hydrochloride
Create Date:
2021-08-21
10.
an image of a chemical structure CID 154328074

MW:
163.200
g/mol
MF:
C9H11N2O-
IUPAC name:
[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]azanide
Create Date:
2020-08-14
11.
an image of a chemical structure CID 153678204

C(N)(=O)[C@H](CC1=CC=CC=C1)[NH-]

MW:
163.200
g/mol
MF:
C9H11N2O-
IUPAC name:
[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]azanide
Create Date:
2020-08-14
12.
an image of a chemical structure CID 148734951

MW:
163.200
g/mol
MF:
C9H11N2O-
IUPAC name:
2-amino-3-phenylpropanimidate
Create Date:
2020-08-12
13.
an image of a chemical structure CID 148549475

MW:
163.200
g/mol
MF:
C9H11N2O-
IUPAC name:
(2S)-2-amino-3-phenylpropanimidate
Create Date:
2020-08-12
14.
an image of a chemical structure CID 148248567

[NH-]C(=O)[C@H](N)CC1=CC=CC=C1

MW:
163.200
g/mol
MF:
C9H11N2O-
IUPAC name:
(2R)-2-amino-3-phenylpropanimidate
Create Date:
2020-08-12
15.
an image of a chemical structure CID 145548085

MW:
194.270
g/mol
MF:
C11H18N2O
IUPAC name:
2-amino-3-phenylpropanamide;ethane
Create Date:
2019-12-12
16.
an image of a chemical structure CID 144591382

MW:
196.250
g/mol
MF:
C10H16N2O2
IUPAC name:
2-amino-3-phenylpropanamide;methanol
Create Date:
2019-12-07
17.
an image of a chemical structure CID 143814561

MW:
202.290
g/mol
MF:
C9H11KN2O
IUPAC name:
potassium;(2-amino-3-phenylpropanoyl)azanide
Create Date:
2019-12-07
18.
an image of a chemical structure CID 143394189

MW:
212.270
g/mol
MF:
C9H12N2O2S
IUPAC name:
2-amino-3-phenylpropanamide;sulfur monoxide
Create Date:
2019-12-07
19.
an image of a chemical structure CID 142110541

MW:
194.270
g/mol
MF:
C11H18N2O
IUPAC name:
(2R)-2-amino-3-phenylpropanamide;ethane
Create Date:
2019-12-06
20.
an image of a chemical structure CID 142070907

MW:
224.340
g/mol
MF:
C13H24N2O
IUPAC name:
2-amino-3-phenylpropanamide;ethane
Create Date:
2019-12-06
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center