Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 14

1.
an image of a chemical structure CID 124586198

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
[(2S)-2,3-dihydroxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-t...
Create Date:
2017-04-10
2.
an image of a chemical structure CID 140136644

MW:
383.600
g/mol
MF:
C23H38O4
IUPAC name:
(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (5Z,8Z,11Z,14Z...
Create Date:
2019-12-06
3.
an image of a chemical structure CID 137700025

5Z,8Z,11Z,14Z-eicosatetraenoicacid,1-glycerylester-d8

MW:
386.600
g/mol
MF:
C23H38O4
IUPAC name:
2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octa...
Create Date:
2019-04-10
4.
an image of a chemical structure CID 91580285

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
[(2S)-2,3-dihydroxypropyl] icosa-5,8,11,14-tetraenoate
Create Date:
2015-03-17
5.
an image of a chemical structure CID 91465633

[2H]C([2H])(O)C([2H])(O)C([2H])([2H])OC(=O)CCCC=C/CC=C/CC=C/CC=C/CCCCC

MW:
383.600
g/mol
MF:
C23H38O4
IUPAC name:
(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) icosa-5,8,11,1...
Create Date:
2015-03-17
6.
an image of a chemical structure CID 91457820

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
[(2R)-2,3-dihydroxypropyl] icosa-5,8,11,14-tetraenoate
Create Date:
2015-03-17
7.
an image of a chemical structure CID 44449059

CHEMBL257406

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
2,3-dihydroxypropyl (5E,8E,11Z,14E)-icosa-5,8,11,14-tetraeno...
Create Date:
2009-11-19
8.
an image of a chemical structure CID 40490622

3-arachidonoyl-sn-glycerol; CHEMBL262560; CHEBI:75571 ...

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
[(2R)-2,3-dihydroxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-t...
Create Date:
2009-05-30
9.
an image of a chemical structure CID 22287859

SCHEMBL1133785; 1-(cis-5,8,11,14-eicosatetraenoyl)glycerol

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
2,3-dihydroxypropyl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraeno...
Create Date:
2007-12-05
10.
an image of a chemical structure CID 16019980

1-Arachidonoyl-sn-glycerol; (S)-glyceryl 1-arachidonate; UNII-P471A4329T ...

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
[(2S)-2,3-dihydroxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-t...
Create Date:
2007-04-03
11.
an image of a chemical structure CID 10134280

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
2,3-dihydroxypropyl (5Z,8Z,11E,14Z)-icosa-5,8,11,14-tetraeno...
Create Date:
2006-10-25
12.
an image of a chemical structure CID 5282281

Glyceryl arachidonate; 1-monoarachidin; 35474-99-8 ...

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraeno...
Create Date:
2005-06-24
13.
an image of a chemical structure CID 114672

129691-05-0; 2,3-dihydroxypropyl icosa-5,8,11,14-tetraenoate; 1-Arachidonoylglycerol ...

MW:
378.500
g/mol
MF:
C23H38O4
IUPAC name:
2,3-dihydroxypropyl icosa-5,8,11,14-tetraenoate
Create Date:
2005-06-24
14.
an image of a chemical structure CID 87552760

SCHEMBL3655030

MW:
531.700
g/mol
MF:
C31H49NO6
IUPAC name:
4-(2-aminoethyl)benzene-1,2-diol;2,3-dihydroxypropyl (5E,8E,...
Create Date:
2015-02-12
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Support Center