Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 2264

1.
an image of a chemical structure CID 969516

curcumin; 458-37-7; Diferuloylmethane ...

MW:
368.400
g/mol
MF:
C21H20O6
IUPAC name:
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,...
Create Date:
2004-09-16
2.
an image of a chemical structure CID 140874178

MW:
374.400
g/mol
MF:
C21H20O6
IUPAC name:
(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[2,3,6-trideuterio-4...
Create Date:
2019-12-06
3.
an image of a chemical structure CID 57396347

[13C]-Curcumin; CHEMBL1916041

MW:
380.290
g/mol
MF:
C21H20O6
IUPAC name:
(1E,6E)-1,7-bis(4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohe...
Create Date:
2012-07-25
4.
an image of a chemical structure CID 53464495

Curcumin-d6; 1246833-26-0; Curcumin D6 ...

MW:
374.400
g/mol
MF:
C21H20O6
IUPAC name:
(1E,6E)-1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta...
Create Date:
2011-10-31
5.
an image of a chemical structure CID 24884282

cis-Curcumin; SCHEMBL6727063; ZINC17255287

MW:
368.400
g/mol
MF:
C21H20O6
IUPAC name:
(1Z,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,...
Create Date:
2008-09-08
6.
an image of a chemical structure CID 6604598

SCHEMBL2804734; CHEMBL1318698; TNP00001 ...

MW:
368.400
g/mol
MF:
C21H20O6
IUPAC name:
(1Z,6Z)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,...
Create Date:
2006-05-30
7.
8.
an image of a chemical structure CID 123810742

Curcumin D6; Diferuloylmethane D6;Natural Yellow 3 D6;Turmeric yellow D6

MW:
374.400
g/mol
MF:
C21H20O6
IUPAC name:
1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta-1,6-die...
Create Date:
2017-01-25
9.
an image of a chemical structure CID 123803212

MW:
371.400
g/mol
MF:
C21H20O6
IUPAC name:
1,2,6-trideuterio-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,...
Create Date:
2017-01-25
10.
an image of a chemical structure CID 123711067

MW:
378.400
g/mol
MF:
C21H20O6
IUPAC name:
1,2,6,7-tetradeuterio-1,7-bis[4-hydroxy-3-(trideuteriomethox...
Create Date:
2017-01-25
11.
an image of a chemical structure CID 123649317

MW:
371.400
g/mol
MF:
C21H20O6
IUPAC name:
1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-(trideuteriomet...
Create Date:
2017-01-25
12.
an image of a chemical structure CID 91216747

MW:
370.400
g/mol
MF:
C21H20O6
IUPAC name:
1,7-dideuterio-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-d...
Create Date:
2015-03-17
13.
an image of a chemical structure CID 154036230

MW:
369.400
g/mol
MF:
C21H21O6+
IUPAC name:
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6...
Create Date:
2020-08-14
14.
an image of a chemical structure CID 147791775

MW:
339.400
g/mol
MF:
C20H19O5+
IUPAC name:
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6...
Create Date:
2020-08-12
15.
an image of a chemical structure CID 146268434

SCHEMBL21585491

MW:
384.400
g/mol
MF:
C22H24O6
IUPAC name:
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,...
Create Date:
2020-06-27
16.
an image of a chemical structure CID 143978546

MW:
398.400
g/mol
MF:
C23H26O6
IUPAC name:
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,...
Create Date:
2019-12-07
17.
an image of a chemical structure CID 141082674

MW:
322.400
g/mol
MF:
C20H18O4
IUPAC name:
(1E)-1-(4-hydroxy-3-methoxyphenyl)-7-phenylhepta-1,6-diene-3...
Create Date:
2019-12-06
18.
an image of a chemical structure CID 140111827

MW:
322.400
g/mol
MF:
C20H18O4
IUPAC name:
(1E,6E)-1-(3-hydroxy-4-methoxyphenyl)-7-phenylhepta-1,6-dien...
Create Date:
2019-12-06
19.
an image of a chemical structure CID 140111826

MW:
382.400
g/mol
MF:
C22H22O6
IUPAC name:
(1E,6E)-1-(3,4-dimethoxyphenyl)-7-(3-hydroxy-4-methoxyphenyl...
Create Date:
2019-12-06
20.
an image of a chemical structure CID 129630417

p-Cumaroylferuloylmethan; SCHEMBL21327853; C1=C(O)C(OC)=CC(\C=C\C(=O)CC(=O)C=CC=2C=CC(O)=CC=2)=C1

MW:
338.400
g/mol
MF:
C20H18O5
IUPAC name:
(1E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-...
Create Date:
2017-09-13
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center