Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 4644

1.
2.
an image of a chemical structure CID 141273820

C1(=CC=C2C=CC=C3C4=CC=CC=C4C1=C23)[2H]

MW:
203.260
g/mol
MF:
C16H10
IUPAC name:
1-deuteriofluoranthene
Create Date:
2019-12-06
3.
an image of a chemical structure CID 129849971

fluoranthene-d8

MW:
210.300
g/mol
MF:
C16H10
IUPAC name:
1,2,3,4,5,6,7,8-octadeuteriofluoranthene
Create Date:
2017-09-13
4.
an image of a chemical structure CID 16219363

Fluoranthene-3-14C; 134459-04-4; Fluoranthene-3-14C(9CI) ...

MW:
204.240
g/mol
MF:
C16H10
IUPAC name:
fluoranthene
Create Date:
2007-07-16
5.
an image of a chemical structure CID 185309

Fluoranthene-d10; 93951-69-0; 1,2,3,4,5,6,7,8,9,10-decadeuteriofluoranthene ...

MW:
212.310
g/mol
MF:
C16H10
IUPAC name:
1,2,3,4,5,6,7,8,9,10-decadeuteriofluoranthene
Create Date:
2005-08-09
6.
an image of a chemical structure CID 150358271

MW:
204.260
g/mol
MF:
C16H10
IUPAC name:
3,10-dideuteriofluoranthene
Create Date:
2020-08-12
7.
an image of a chemical structure CID 142298122

MW:
200.230
g/mol
MF:
C16H8
IUPAC name:
7,8-didehydrofluoranthene
Create Date:
2019-12-06
8.
an image of a chemical structure CID 4075743

(phenylmethylidene)acenaphthene; AKOS034450783; MCULE-8927628358 ...

MW:
242.300
g/mol
MF:
C19H14
IUPAC name:
2-benzylidene-1H-acenaphthylene
Create Date:
2005-09-13
9.
an image of a chemical structure CID 2317213

MW:
242.300
g/mol
MF:
C19H14
IUPAC name:
(2E)-2-benzylidene-1H-acenaphthylene
Create Date:
2005-07-15
10.
an image of a chemical structure CID 152569532

MW:
332.500
g/mol
MF:
C19H13Zr-
IUPAC name:
1-(1H-inden-1-id-2-yl)naphthalene;zirconium
Create Date:
2020-08-13
11.
an image of a chemical structure CID 145283604

MW:
218.290
g/mol
MF:
C17H14
IUPAC name:
fluoranthene;methane
Create Date:
2019-12-07
12.
an image of a chemical structure CID 142298151

MW:
330.160
g/mol
MF:
C16H11I
IUPAC name:
fluoranthene;hydroiodide
Create Date:
2019-12-06
13.
an image of a chemical structure CID 142298121

MW:
230.300
g/mol
MF:
C18H14
Create Date:
2019-12-06
14.
an image of a chemical structure CID 20513178

MW:
238.710
g/mol
MF:
C16H11Cl
IUPAC name:
fluoranthene;hydrochloride
Create Date:
2007-12-05
15.
an image of a chemical structure CID 11031695

1-phenylacenaphthene; 1-phenyl-1,2-dihydroacenaphthylene

MW:
230.300
g/mol
MF:
C18H14
IUPAC name:
1-phenyl-1,2-dihydroacenaphthylene
Create Date:
2006-10-26
16.
an image of a chemical structure CID 146751

7-Methylfluoranthene; Fluoranthene, 7-methyl-; UNII-7HW0D2U02V ...

MW:
216.280
g/mol
MF:
C17H12
IUPAC name:
7-methylfluoranthene
Create Date:
2005-08-08
17.
an image of a chemical structure CID 154152042

CC=1C(C2=CC=CC(=C2C1)C1=CC=CC2=CC=CC=C12)[Hf]

MW:
433.800
g/mol
MF:
C20H15Hf-
IUPAC name:
hafnium;1-(2-methyl-1H-inden-1-id-4-yl)naphthalene
Create Date:
2020-08-14
18.
an image of a chemical structure CID 153739115

CC=1C(C2=CC=CC(=C2C=1)C1=CC=CC2=CC=CC=C12)[Ti]

MW:
303.200
g/mol
MF:
C20H15Ti-
IUPAC name:
1-(2-methyl-1H-inden-1-id-4-yl)naphthalene;titanium
Create Date:
2020-08-14
19.
an image of a chemical structure CID 153721006

C1(=CC=CC2=CC=CC=C12)C1=C2C=CC(C2=CC=C1)[Zr]

MW:
332.500
g/mol
MF:
C19H13Zr-
IUPAC name:
1-(1H-inden-1-id-4-yl)naphthalene;zirconium
Create Date:
2020-08-14
20.
an image of a chemical structure CID 152763226

C1=CC=CC2=CC(C=3C4=CC=CC=C4[CH-]C=3)=CC=C21

MW:
241.300
g/mol
MF:
C19H13-
IUPAC name:
2-inden-3a-id-1-ylnaphthalene
Create Date:
2020-08-13
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center