Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 7

1.
an image of a chemical structure CID 3086673

Pegorgotein; 2-methoxyethyl 4-amino-4-oxobutanoate; 155773-57-2 ...

MW:
175.180
g/mol
MF:
C7H13NO4
IUPAC name:
2-methoxyethyl 4-amino-4-oxobutanoate
Create Date:
2005-08-09
2.
an image of a chemical structure CID 148726176

MW:
219.230
g/mol
MF:
C9H17NO5
IUPAC name:
2-(2-methoxyethoxy)ethyl 4-amino-4-oxobutanoate
Create Date:
2020-08-12
3.
an image of a chemical structure CID 54361788

propyl 4-amino-4-oxobutanoate

MW:
159.180
g/mol
MF:
C7H13NO3
IUPAC name:
propyl 4-amino-4-oxobutanoate
Create Date:
2011-12-04
4.
an image of a chemical structure CID 54165525

SCHEMBL11231125; 2-(4-amino-4-oxobutoxy)ethyl acetate

MW:
189.210
g/mol
MF:
C8H15NO4
IUPAC name:
2-(4-amino-4-oxobutoxy)ethyl acetate
Create Date:
2011-12-04
5.
an image of a chemical structure CID 13347133

Succinamic acid ethyl ester; ethyl 4-amino-4-oxobutanoate; 53171-35-0 ...

MW:
145.160
g/mol
MF:
C6H11NO3
IUPAC name:
ethyl 4-amino-4-oxobutanoate
Create Date:
2007-02-08
6.
an image of a chemical structure CID 153738125

C(CCC(=O)N)(=O)OCC(=O)OCC

MW:
203.190
g/mol
MF:
C8H13NO5
IUPAC name:
(2-ethoxy-2-oxoethyl) 4-amino-4-oxobutanoate
Create Date:
2020-08-14
7.
an image of a chemical structure CID 54016028

butyl 4-amino-4-oxobutanoate; SCHEMBL7149699

MW:
173.210
g/mol
MF:
C8H15NO3
IUPAC name:
butyl 4-amino-4-oxobutanoate
Create Date:
2011-12-04
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center